About CID 158929584
CID 158929584 (PubChem CID 158929584) has the molecular formula C3H10NaO3
and a molecular weight of 117.10 g/mol.
Molecular Properties
| Compound Name | CID 158929584 |
| PubChem CID | 158929584 |
| Molecular Formula | C3H10NaO3 |
| Molecular Weight | 117.10 g/mol |
| Exact Mass | 117.05 |
| IUPAC Name | — |
| SMILES | CC(O)CO.O.[Na] |
| InChI | InChI=1S/C3H8O2.Na.H2O/c1-3(5)2-4;;/h3-5H,2H2,1H3;;1H2 |
| InChIKey | JIWMYJBKGWVNPV-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 158929584 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158929584?
The IUPAC name of CID 158929584 (CID 158929584) is not available.
What is the SMILES notation for CID 158929584?
The canonical SMILES for CID 158929584 is CC(O)CO.O.[Na].
What is the InChIKey of CID 158929584?
The InChIKey is JIWMYJBKGWVNPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.Na.H2O/c1-3(5)2-4;;/h3-5H,2H2,1H3;;1H2.
What are the key properties of CID 158929584?
CID 158929584 has a molecular weight of 117.10 g/mol, XLogP of -1.85, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158929584 is sourced from PubChem (CID 158929584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).