C3H10O5Se — CID 88681606
propane-1,2-diol;selenous acid (PubChem CID 88681606) has the molecular formula C3H10O5Se and a molecular weight of 205.07 g/mol. Its IUPAC name is propane-1,2-diol;selenous acid.
| Compound Name | propane-1,2-diol;selenous acid |
|---|---|
| PubChem CID | 88681606 |
| Molecular Formula | C3H10O5Se |
| Molecular Weight | 205.07 g/mol |
| Exact Mass | 205.97 |
| IUPAC Name | propane-1,2-diol;selenous acid |
| SMILES | CC(O)CO.O=[Se](O)O |
| InChI | InChI=1S/C3H8O2.H2O3Se/c1-3(5)2-4;1-4(2)3/h3-5H,2H2,1H3;(H2,1,2,3) |
| InChIKey | DJIZIJYGRAVYSG-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.07 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|