C6H9ClF3NO3 — CID 88638581
4-chloro-5,5,5-trifluoro-2-methyl-3-nitropentan-2-ol (PubChem CID 88638581) has the molecular formula C6H9ClF3NO3 and a molecular weight of 235.59 g/mol. Its IUPAC name is 4-chloro-5,5,5-trifluoro-2-methyl-3-nitropentan-2-ol.
| Compound Name | 4-chloro-5,5,5-trifluoro-2-methyl-3-nitropentan-2-ol |
|---|---|
| PubChem CID | 88638581 |
| Molecular Formula | C6H9ClF3NO3 |
| Molecular Weight | 235.59 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 4-chloro-5,5,5-trifluoro-2-methyl-3-nitropentan-2-ol |
| SMILES | CC(C)(O)C(C(Cl)C(F)(F)F)[N+](=O)[O-] |
| InChI | InChI=1S/C6H9ClF3NO3/c1-5(2,12)4(11(13)14)3(7)6(8,9)10/h3-4,12H,1-2H3 |
| InChIKey | VFVCHPGKWHYAPZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.59 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|