C10H9ClF3NO3 — CID 14699127
1-chloro-4-(3,3,3-trifluoro-1-methoxy-2-nitropropyl)benzene (PubChem CID 14699127) has the molecular formula C10H9ClF3NO3 and a molecular weight of 283.63 g/mol. Its IUPAC name is 1-chloro-4-(3,3,3-trifluoro-1-methoxy-2-nitropropyl)benzene.
| Compound Name | 1-chloro-4-(3,3,3-trifluoro-1-methoxy-2-nitropropyl)benzene |
|---|---|
| PubChem CID | 14699127 |
| Molecular Formula | C10H9ClF3NO3 |
| Molecular Weight | 283.63 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 1-chloro-4-(3,3,3-trifluoro-1-methoxy-2-nitropropyl)benzene |
| SMILES | COC(c1ccc(Cl)cc1)C([N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C10H9ClF3NO3/c1-18-8(6-2-4-7(11)5-3-6)9(15(16)17)10(12,13)14/h2-5,8-9H,1H3 |
| InChIKey | HFGUZKLTYQDPII-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|