C4H7N5O9 — CID 22757342
N-(2-hydroxy-3,4,4-trinitrobutan-2-yl)nitramide (PubChem CID 22757342) has the molecular formula C4H7N5O9 and a molecular weight of 269.13 g/mol. Its IUPAC name is N-(2-hydroxy-3,4,4-trinitrobutan-2-yl)nitramide.
| Compound Name | N-(2-hydroxy-3,4,4-trinitrobutan-2-yl)nitramide |
|---|---|
| PubChem CID | 22757342 |
| Molecular Formula | C4H7N5O9 |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | N-(2-hydroxy-3,4,4-trinitrobutan-2-yl)nitramide |
| SMILES | CC(O)(N[N+](=O)[O-])C(C([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C4H7N5O9/c1-4(10,5-9(17)18)2(6(11)12)3(7(13)14)8(15)16/h2-3,5,10H,1H3 |
| InChIKey | ZKDRLRYQVSFZAL-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 204.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|