About calcium methyl nitrate
calcium methyl nitrate (PubChem CID 87508998) has the molecular formula CH3CaNO3+2
and a molecular weight of 117.12 g/mol. Its IUPAC name is calcium methyl nitrate.
Molecular Properties
| Compound Name | calcium methyl nitrate |
| PubChem CID | 87508998 |
| Molecular Formula | CH3CaNO3+2 |
| Molecular Weight | 117.12 g/mol |
| Exact Mass | 116.97 |
| IUPAC Name | calcium methyl nitrate |
| SMILES | CO[N+](=O)[O-].[Ca+2] |
| InChI | InChI=1S/CH3NO3.Ca/c1-5-2(3)4;/h1H3;/q;+2 |
| InChIKey | DUUQCERVIDZGTC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.12 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze calcium methyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium methyl nitrate?
The IUPAC name of calcium methyl nitrate (CID 87508998) is calcium methyl nitrate.
What is the SMILES notation for calcium methyl nitrate?
The canonical SMILES for calcium methyl nitrate is CO[N+](=O)[O-].[Ca+2].
What is the InChIKey of calcium methyl nitrate?
The InChIKey is DUUQCERVIDZGTC-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NO3.Ca/c1-5-2(3)4;/h1H3;/q;+2.
What are the key properties of calcium methyl nitrate?
calcium methyl nitrate has a molecular weight of 117.12 g/mol, XLogP of -0.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium methyl nitrate is sourced from PubChem (CID 87508998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).