About methoxymethyl nitrate;methyl nitrate;hydroiodide
methoxymethyl nitrate;methyl nitrate;hydroiodide (PubChem CID 161097007) has the molecular formula C3H9IN2O7
and a molecular weight of 312.02 g/mol. Its IUPAC name is methoxymethyl nitrate;methyl nitrate;hydroiodide.
Molecular Properties
| Compound Name | methoxymethyl nitrate;methyl nitrate;hydroiodide |
| PubChem CID | 161097007 |
| Molecular Formula | C3H9IN2O7 |
| Molecular Weight | 312.02 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | methoxymethyl nitrate;methyl nitrate;hydroiodide |
| SMILES | COCO[N+](=O)[O-].CO[N+](=O)[O-].I |
| InChI | InChI=1S/C2H5NO4.CH3NO3.HI/c1-6-2-7-3(4)5;1-5-2(3)4;/h2H2,1H3;1H3;1H |
| InChIKey | AEYIGNUXMNTMQA-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.02 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methoxymethyl nitrate;methyl nitrate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethyl nitrate;methyl nitrate;hydroiodide?
The IUPAC name of methoxymethyl nitrate;methyl nitrate;hydroiodide (CID 161097007) is methoxymethyl nitrate;methyl nitrate;hydroiodide.
What is the SMILES notation for methoxymethyl nitrate;methyl nitrate;hydroiodide?
The canonical SMILES for methoxymethyl nitrate;methyl nitrate;hydroiodide is COCO[N+](=O)[O-].CO[N+](=O)[O-].I.
What is the InChIKey of methoxymethyl nitrate;methyl nitrate;hydroiodide?
The InChIKey is AEYIGNUXMNTMQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO4.CH3NO3.HI/c1-6-2-7-3(4)5;1-5-2(3)4;/h2H2,1H3;1H3;1H.
What are the key properties of methoxymethyl nitrate;methyl nitrate;hydroiodide?
methoxymethyl nitrate;methyl nitrate;hydroiodide has a molecular weight of 312.02 g/mol, XLogP of 0.24, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethyl nitrate;methyl nitrate;hydroiodide is sourced from PubChem (CID 161097007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).