About 3-methylbut-2-enyl nitrate
3-methylbut-2-enyl nitrate (PubChem CID 10219448) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is 3-methylbut-2-enyl nitrate.
Molecular Properties
| Compound Name | 3-methylbut-2-enyl nitrate |
| PubChem CID | 10219448 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 3-methylbut-2-enyl nitrate |
| SMILES | CC(C)=CCO[N+](=O)[O-] |
| InChI | InChI=1S/C5H9NO3/c1-5(2)3-4-9-6(7)8/h3H,4H2,1-2H3 |
| InChIKey | JGPSMIZUBRLMOI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enyl nitrate?
The IUPAC name of 3-methylbut-2-enyl nitrate (CID 10219448) is 3-methylbut-2-enyl nitrate.
What is the SMILES notation for 3-methylbut-2-enyl nitrate?
The canonical SMILES for 3-methylbut-2-enyl nitrate is CC(C)=CCO[N+](=O)[O-].
What is the InChIKey of 3-methylbut-2-enyl nitrate?
The InChIKey is JGPSMIZUBRLMOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-5(2)3-4-9-6(7)8/h3H,4H2,1-2H3.
What are the key properties of 3-methylbut-2-enyl nitrate?
3-methylbut-2-enyl nitrate has a molecular weight of 131.13 g/mol, XLogP of 1.16, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enyl nitrate is sourced from PubChem (CID 10219448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).