C20H38O8P2 — CID 166721713
bis(3-methylbut-2-enoxy)phosphoryl bis(3-methylbut-2-enyl) phosphate;hydrate (PubChem CID 166721713) has the molecular formula C20H38O8P2 and a molecular weight of 468.46 g/mol. Its IUPAC name is bis(3-methylbut-2-enoxy)phosphoryl bis(3-methylbut-2-enyl) phosphate;hydrate.
| Compound Name | bis(3-methylbut-2-enoxy)phosphoryl bis(3-methylbut-2-enyl) phosphate;hydrate |
|---|---|
| PubChem CID | 166721713 |
| Molecular Formula | C20H38O8P2 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | bis(3-methylbut-2-enoxy)phosphoryl bis(3-methylbut-2-enyl) phosphate;hydrate |
| SMILES | CC(C)=CCOP(=O)(OCC=C(C)C)OP(=O)(OCC=C(C)C)OCC=C(C)C.O |
| InChI | InChI=1S/C20H36O7P2.H2O/c1-17(2)9-13-23-28(21,24-14-10-18(3)4)27-29(22,25-15-11-19(5)6)26-16-12-20(7)8;/h9-12H,13-16H2,1-8H3;1H2 |
| InChIKey | LLIPCDUSVZECJZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 111.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|