C20H36O11P2 — CID 87471449
bis[(E)-4-hydroxy-2-methylbut-2-enoxy]phosphoryl bis[(E)-4-hydroxy-2-methylbut-2-enyl] phosphate (PubChem CID 87471449) has the molecular formula C20H36O11P2 and a molecular weight of 514.45 g/mol. Its IUPAC name is bis[(E)-4-hydroxy-2-methylbut-2-enoxy]phosphoryl bis[(E)-4-hydroxy-2-methylbut-2-enyl] phosphate.
| Compound Name | bis[(E)-4-hydroxy-2-methylbut-2-enoxy]phosphoryl bis[(E)-4-hydroxy-2-methylbut-2-enyl] phosphate |
|---|---|
| PubChem CID | 87471449 |
| Molecular Formula | C20H36O11P2 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | bis[(E)-4-hydroxy-2-methylbut-2-enoxy]phosphoryl bis[(E)-4-hydroxy-2-methylbut-2-enyl] phosphate |
| SMILES | C/C(=C\CO)COP(=O)(OC/C(C)=C/CO)OP(=O)(OC/C(C)=C/CO)OC/C(C)=C/CO |
| InChI | InChI=1S/C20H36O11P2/c1-17(5-9-21)13-27-32(25,28-14-18(2)6-10-22)31-33(26,29-15-19(3)7-11-23)30-16-20(4)8-12-24/h5-8,21-24H,9-16H2,1-4H3/b17-5+,18-6+,19-7+,20-8+ |
| InChIKey | ARARGIZQILKEOB-MVXDNDCSSA-N |
| XLogP | 3.04 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|