C21H36O2 — CID 101334323
(2E,6E,10E,14E)-16-methoxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol (PubChem CID 101334323) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (2E,6E,10E,14E)-16-methoxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol.
| Compound Name | (2E,6E,10E,14E)-16-methoxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol |
|---|---|
| PubChem CID | 101334323 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | (2E,6E,10E,14E)-16-methoxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol |
| SMILES | COC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C21H36O2/c1-18(11-7-13-20(3)15-16-22)9-6-10-19(2)12-8-14-21(4)17-23-5/h10-11,14-15,22H,6-9,12-13,16-17H2,1-5H3/b18-11+,19-10+,20-15+,21-14+ |
| InChIKey | SQDZHLJBSDVMLR-MBJWKAJASA-N |
| XLogP | 5.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|