C13H22O2 — CID 164608860
(2E,6E)-3,7-dimethyl-8-prop-2-enoxyocta-2,6-dien-1-ol (PubChem CID 164608860) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (2E,6E)-3,7-dimethyl-8-prop-2-enoxyocta-2,6-dien-1-ol.
| Compound Name | (2E,6E)-3,7-dimethyl-8-prop-2-enoxyocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 164608860 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (2E,6E)-3,7-dimethyl-8-prop-2-enoxyocta-2,6-dien-1-ol |
| SMILES | C=CCOC/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C13H22O2/c1-4-10-15-11-13(3)7-5-6-12(2)8-9-14/h4,7-8,14H,1,5-6,9-11H2,2-3H3/b12-8+,13-7+ |
| InChIKey | KANLUNNZVJTEQW-SWZPTJTJSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|