C12H22O — CID 54398542
7-ethyl-3-methylnona-2,6-dien-1-ol (PubChem CID 54398542) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 7-ethyl-3-methylnona-2,6-dien-1-ol.
| Compound Name | 7-ethyl-3-methylnona-2,6-dien-1-ol |
|---|---|
| PubChem CID | 54398542 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 7-ethyl-3-methylnona-2,6-dien-1-ol |
| SMILES | CCC(=CCCC(C)=CCO)CC |
| InChI | InChI=1S/C12H22O/c1-4-12(5-2)8-6-7-11(3)9-10-13/h8-9,13H,4-7,10H2,1-3H3 |
| InChIKey | VLTCLGWJQZNPLR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|