C5H9N3O3 — CID 91421144
(3S,4S)-3-azido-4,5-dihydroxypentanal (PubChem CID 91421144) has the molecular formula C5H9N3O3 and a molecular weight of 159.14 g/mol. Its IUPAC name is (3S,4S)-3-azido-4,5-dihydroxypentanal.
| Compound Name | (3S,4S)-3-azido-4,5-dihydroxypentanal |
|---|---|
| PubChem CID | 91421144 |
| Molecular Formula | C5H9N3O3 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | (3S,4S)-3-azido-4,5-dihydroxypentanal |
| SMILES | [N-]=[N+]=N[C@@H](CC=O)[C@H](O)CO |
| InChI | InChI=1S/C5H9N3O3/c6-8-7-4(1-2-9)5(11)3-10/h2,4-5,10-11H,1,3H2/t4-,5+/m0/s1 |
| InChIKey | CCRXJMDIIXJVIC-CRCLSJGQSA-N |
| XLogP | -0.39 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|