About 3-azido-4-methylpentanal
3-azido-4-methylpentanal (PubChem CID 16744415) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-azido-4-methylpentanal.
Molecular Properties
| Compound Name | 3-azido-4-methylpentanal |
| PubChem CID | 16744415 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 3-azido-4-methylpentanal |
| SMILES | CC(C)C(CC=O)N=[N+]=[N-] |
| InChI | InChI=1S/C6H11N3O/c1-5(2)6(3-4-10)8-9-7/h4-6H,3H2,1-2H3 |
| InChIKey | ZUYDBAKFEKCCKM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-azido-4-methylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azido-4-methylpentanal?
The IUPAC name of 3-azido-4-methylpentanal (CID 16744415) is 3-azido-4-methylpentanal.
What is the SMILES notation for 3-azido-4-methylpentanal?
The canonical SMILES for 3-azido-4-methylpentanal is CC(C)C(CC=O)N=[N+]=[N-].
What is the InChIKey of 3-azido-4-methylpentanal?
The InChIKey is ZUYDBAKFEKCCKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O/c1-5(2)6(3-4-10)8-9-7/h4-6H,3H2,1-2H3.
What are the key properties of 3-azido-4-methylpentanal?
3-azido-4-methylpentanal has a molecular weight of 141.17 g/mol, XLogP of 1.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azido-4-methylpentanal is sourced from PubChem (CID 16744415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).