About (5R)-5-azidooctanal
(5R)-5-azidooctanal (PubChem CID 10352103) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is (5R)-5-azidooctanal.
Molecular Properties
| Compound Name | (5R)-5-azidooctanal |
| PubChem CID | 10352103 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | (5R)-5-azidooctanal |
| SMILES | CCC[C@H](CCCC=O)N=[N+]=[N-] |
| InChI | InChI=1S/C8H15N3O/c1-2-5-8(10-11-9)6-3-4-7-12/h7-8H,2-6H2,1H3/t8-/m1/s1 |
| InChIKey | JQQYGNORCMYAEY-MRVPVSSYSA-N |
| XLogP | 2.83 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-azidooctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-azidooctanal?
The IUPAC name of (5R)-5-azidooctanal (CID 10352103) is (5R)-5-azidooctanal.
What is the SMILES notation for (5R)-5-azidooctanal?
The canonical SMILES for (5R)-5-azidooctanal is CCC[C@H](CCCC=O)N=[N+]=[N-].
What is the InChIKey of (5R)-5-azidooctanal?
The InChIKey is JQQYGNORCMYAEY-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-2-5-8(10-11-9)6-3-4-7-12/h7-8H,2-6H2,1H3/t8-/m1/s1.
What are the key properties of (5R)-5-azidooctanal?
(5R)-5-azidooctanal has a molecular weight of 169.23 g/mol, XLogP of 2.83, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-azidooctanal is sourced from PubChem (CID 10352103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).