About 6-azidodecanamide
6-azidodecanamide (PubChem CID 175969614) has the molecular formula C10H20N4O
and a molecular weight of 212.30 g/mol. Its IUPAC name is 6-azidodecanamide.
Molecular Properties
| Compound Name | 6-azidodecanamide |
| PubChem CID | 175969614 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 6-azidodecanamide |
| SMILES | CCCCC(CCCCC(N)=O)N=[N+]=[N-] |
| InChI | InChI=1S/C10H20N4O/c1-2-3-6-9(13-14-12)7-4-5-8-10(11)15/h9H,2-8H2,1H3,(H2,11,15) |
| InChIKey | OLLPAVIAGSUGOU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-azidodecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azidodecanamide?
The IUPAC name of 6-azidodecanamide (CID 175969614) is 6-azidodecanamide.
What is the SMILES notation for 6-azidodecanamide?
The canonical SMILES for 6-azidodecanamide is CCCCC(CCCCC(N)=O)N=[N+]=[N-].
What is the InChIKey of 6-azidodecanamide?
The InChIKey is OLLPAVIAGSUGOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4O/c1-2-3-6-9(13-14-12)7-4-5-8-10(11)15/h9H,2-8H2,1H3,(H2,11,15).
What are the key properties of 6-azidodecanamide?
6-azidodecanamide has a molecular weight of 212.30 g/mol, XLogP of 2.90, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azidodecanamide is sourced from PubChem (CID 175969614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).