About 12-azidooctadec-9-enoic acid
12-azidooctadec-9-enoic acid (PubChem CID 53422645) has the molecular formula C18H33N3O2
and a molecular weight of 323.48 g/mol. Its IUPAC name is 12-azidooctadec-9-enoic acid.
Molecular Properties
| Compound Name | 12-azidooctadec-9-enoic acid |
| PubChem CID | 53422645 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | 12-azidooctadec-9-enoic acid |
| SMILES | CCCCCCC(CC=CCCCCCCCC(=O)O)N=[N+]=[N-] |
| InChI | InChI=1S/C18H33N3O2/c1-2-3-4-11-14-17(20-21-19)15-12-9-7-5-6-8-10-13-16-18(22)23/h9,12,17H,2-8,10-11,13-16H2,1H3,(H,22,23) |
| InChIKey | XRCPMRYVFRFJPE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 12-azidooctadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-azidooctadec-9-enoic acid?
The IUPAC name of 12-azidooctadec-9-enoic acid (CID 53422645) is 12-azidooctadec-9-enoic acid.
What is the SMILES notation for 12-azidooctadec-9-enoic acid?
The canonical SMILES for 12-azidooctadec-9-enoic acid is CCCCCCC(CC=CCCCCCCCC(=O)O)N=[N+]=[N-].
What is the InChIKey of 12-azidooctadec-9-enoic acid?
The InChIKey is XRCPMRYVFRFJPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33N3O2/c1-2-3-4-11-14-17(20-21-19)15-12-9-7-5-6-8-10-13-16-18(22)23/h9,12,17H,2-8,10-11,13-16H2,1H3,(H,22,23).
What are the key properties of 12-azidooctadec-9-enoic acid?
12-azidooctadec-9-enoic acid has a molecular weight of 323.48 g/mol, XLogP of 6.40, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-azidooctadec-9-enoic acid is sourced from PubChem (CID 53422645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).