About 6,7-diazidododecane
6,7-diazidododecane (PubChem CID 122603304) has the molecular formula C12H24N6
and a molecular weight of 252.37 g/mol. Its IUPAC name is 6,7-diazidododecane.
Molecular Properties
| Compound Name | 6,7-diazidododecane |
| PubChem CID | 122603304 |
| Molecular Formula | C12H24N6 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 6,7-diazidododecane |
| SMILES | CCCCCC(N=[N+]=[N-])C(CCCCC)N=[N+]=[N-] |
| InChI | InChI=1S/C12H24N6/c1-3-5-7-9-11(15-17-13)12(16-18-14)10-8-6-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | XZFGZJYLDUBOPF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6,7-diazidododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-diazidododecane?
The IUPAC name of 6,7-diazidododecane (CID 122603304) is 6,7-diazidododecane.
What is the SMILES notation for 6,7-diazidododecane?
The canonical SMILES for 6,7-diazidododecane is CCCCCC(N=[N+]=[N-])C(CCCCC)N=[N+]=[N-].
What is the InChIKey of 6,7-diazidododecane?
The InChIKey is XZFGZJYLDUBOPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N6/c1-3-5-7-9-11(15-17-13)12(16-18-14)10-8-6-4-2/h11-12H,3-10H2,1-2H3.
What are the key properties of 6,7-diazidododecane?
6,7-diazidododecane has a molecular weight of 252.37 g/mol, XLogP of 5.50, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-diazidododecane is sourced from PubChem (CID 122603304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).