C10H21N3O3 — CID 90749727
(2S,3S,4R)-2-azidodecane-1,3,4-triol (PubChem CID 90749727) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is (2S,3S,4R)-2-azidodecane-1,3,4-triol.
| Compound Name | (2S,3S,4R)-2-azidodecane-1,3,4-triol |
|---|---|
| PubChem CID | 90749727 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (2S,3S,4R)-2-azidodecane-1,3,4-triol |
| SMILES | CCCCCC[C@@H](O)[C@@H](O)[C@H](CO)N=[N+]=[N-] |
| InChI | InChI=1S/C10H21N3O3/c1-2-3-4-5-6-9(15)10(16)8(7-14)12-13-11/h8-10,14-16H,2-7H2,1H3/t8-,9+,10-/m0/s1 |
| InChIKey | GQPAQJNVAUNFRE-AEJSXWLSSA-N |
| XLogP | 1.35 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|