C18H37N3O3 — CID 14017259
2-azidooctadecane-1,3,4-triol (PubChem CID 14017259) has the molecular formula C18H37N3O3 and a molecular weight of 343.51 g/mol. Its IUPAC name is 2-azidooctadecane-1,3,4-triol.
| Compound Name | 2-azidooctadecane-1,3,4-triol |
|---|---|
| PubChem CID | 14017259 |
| Molecular Formula | C18H37N3O3 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.28 |
| IUPAC Name | 2-azidooctadecane-1,3,4-triol |
| SMILES | CCCCCCCCCCCCCCC(O)C(O)C(CO)N=[N+]=[N-] |
| InChI | InChI=1S/C18H37N3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(23)18(24)16(15-22)20-21-19/h16-18,22-24H,2-15H2,1H3 |
| InChIKey | MUTDVCKHIMUXFS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|