C15H30N6O2 — CID 10544133
(4S,6R)-4,6-diazido-1,1-dimethoxytridecane (PubChem CID 10544133) has the molecular formula C15H30N6O2 and a molecular weight of 326.45 g/mol. Its IUPAC name is (4S,6R)-4,6-diazido-1,1-dimethoxytridecane.
| Compound Name | (4S,6R)-4,6-diazido-1,1-dimethoxytridecane |
|---|---|
| PubChem CID | 10544133 |
| Molecular Formula | C15H30N6O2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | (4S,6R)-4,6-diazido-1,1-dimethoxytridecane |
| SMILES | CCCCCCC[C@H](C[C@H](CCC(OC)OC)N=[N+]=[N-])N=[N+]=[N-] |
| InChI | InChI=1S/C15H30N6O2/c1-4-5-6-7-8-9-13(18-20-16)12-14(19-21-17)10-11-15(22-2)23-3/h13-15H,4-12H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | RNQLCQWIQBWRRB-KGLIPLIRSA-N |
| XLogP | 5.49 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|