C16H34O3 — CID 98092966
(1R,3R)-1-ethoxy-1,3-dimethoxydodecane (PubChem CID 98092966) has the molecular formula C16H34O3 and a molecular weight of 274.44 g/mol. Its IUPAC name is (1R,3R)-1-ethoxy-1,3-dimethoxydodecane.
| Compound Name | (1R,3R)-1-ethoxy-1,3-dimethoxydodecane |
|---|---|
| PubChem CID | 98092966 |
| Molecular Formula | C16H34O3 |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.25 |
| IUPAC Name | (1R,3R)-1-ethoxy-1,3-dimethoxydodecane |
| SMILES | CCCCCCCCC[C@H](C[C@H](OC)OCC)OC |
| InChI | InChI=1S/C16H34O3/c1-5-7-8-9-10-11-12-13-15(17-3)14-16(18-4)19-6-2/h15-16H,5-14H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | JWANSQVVYWAKTI-HZPDHXFCSA-N |
| XLogP | 4.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|