About 2-ethoxy-1-iododecane
2-ethoxy-1-iododecane (PubChem CID 13149348) has the molecular formula C12H25IO
and a molecular weight of 312.24 g/mol. Its IUPAC name is 2-ethoxy-1-iododecane.
Molecular Properties
| Compound Name | 2-ethoxy-1-iododecane |
| PubChem CID | 13149348 |
| Molecular Formula | C12H25IO |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-ethoxy-1-iododecane |
| SMILES | CCCCCCCCC(CI)OCC |
| InChI | InChI=1S/C12H25IO/c1-3-5-6-7-8-9-10-12(11-13)14-4-2/h12H,3-11H2,1-2H3 |
| InChIKey | UJZGOOSCYYTPFS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-1-iododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-1-iododecane?
The IUPAC name of 2-ethoxy-1-iododecane (CID 13149348) is 2-ethoxy-1-iododecane.
What is the SMILES notation for 2-ethoxy-1-iododecane?
The canonical SMILES for 2-ethoxy-1-iododecane is CCCCCCCCC(CI)OCC.
What is the InChIKey of 2-ethoxy-1-iododecane?
The InChIKey is UJZGOOSCYYTPFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25IO/c1-3-5-6-7-8-9-10-12(11-13)14-4-2/h12H,3-11H2,1-2H3.
What are the key properties of 2-ethoxy-1-iododecane?
2-ethoxy-1-iododecane has a molecular weight of 312.24 g/mol, XLogP of 4.58, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-1-iododecane is sourced from PubChem (CID 13149348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).