About (2R)-2-azidohexadecane
(2R)-2-azidohexadecane (PubChem CID 174670947) has the molecular formula C16H33N3
and a molecular weight of 267.46 g/mol. Its IUPAC name is (2R)-2-azidohexadecane.
Molecular Properties
| Compound Name | (2R)-2-azidohexadecane |
| PubChem CID | 174670947 |
| Molecular Formula | C16H33N3 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.27 |
| IUPAC Name | (2R)-2-azidohexadecane |
| SMILES | CCCCCCCCCCCCCC[C@@H](C)N=[N+]=[N-] |
| InChI | InChI=1S/C16H33N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)18-19-17/h16H,3-15H2,1-2H3/t16-/m1/s1 |
| InChIKey | FHXUAKKUVZJSFU-MRXNPFEDSA-N |
| XLogP | 6.78 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-azidohexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-azidohexadecane?
The IUPAC name of (2R)-2-azidohexadecane (CID 174670947) is (2R)-2-azidohexadecane.
What is the SMILES notation for (2R)-2-azidohexadecane?
The canonical SMILES for (2R)-2-azidohexadecane is CCCCCCCCCCCCCC[C@@H](C)N=[N+]=[N-].
What is the InChIKey of (2R)-2-azidohexadecane?
The InChIKey is FHXUAKKUVZJSFU-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H33N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)18-19-17/h16H,3-15H2,1-2H3/t16-/m1/s1.
What are the key properties of (2R)-2-azidohexadecane?
(2R)-2-azidohexadecane has a molecular weight of 267.46 g/mol, XLogP of 6.78, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-azidohexadecane is sourced from PubChem (CID 174670947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).