About (2S)-2-azidononane
(2S)-2-azidononane (PubChem CID 102115708) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is (2S)-2-azidononane.
Molecular Properties
| Compound Name | (2S)-2-azidononane |
| PubChem CID | 102115708 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | (2S)-2-azidononane |
| SMILES | CCCCCCC[C@H](C)N=[N+]=[N-] |
| InChI | InChI=1S/C9H19N3/c1-3-4-5-6-7-8-9(2)11-12-10/h9H,3-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | HXTMUXMGGKYJLB-VIFPVBQESA-N |
| XLogP | 4.05 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-azidononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-azidononane?
The IUPAC name of (2S)-2-azidononane (CID 102115708) is (2S)-2-azidononane.
What is the SMILES notation for (2S)-2-azidononane?
The canonical SMILES for (2S)-2-azidononane is CCCCCCC[C@H](C)N=[N+]=[N-].
What is the InChIKey of (2S)-2-azidononane?
The InChIKey is HXTMUXMGGKYJLB-VIFPVBQESA-N. The full InChI is InChI=1S/C9H19N3/c1-3-4-5-6-7-8-9(2)11-12-10/h9H,3-8H2,1-2H3/t9-/m0/s1.
What are the key properties of (2S)-2-azidononane?
(2S)-2-azidononane has a molecular weight of 169.27 g/mol, XLogP of 4.05, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-azidononane is sourced from PubChem (CID 102115708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).