C10H20O8 — CID 155345176
(3S,4R)-3,4,5-trihydroxypentanal;3,4,5-trihydroxypentanal (PubChem CID 155345176) has the molecular formula C10H20O8 and a molecular weight of 268.26 g/mol. Its IUPAC name is (3S,4R)-3,4,5-trihydroxypentanal;3,4,5-trihydroxypentanal.
| Compound Name | (3S,4R)-3,4,5-trihydroxypentanal;3,4,5-trihydroxypentanal |
|---|---|
| PubChem CID | 155345176 |
| Molecular Formula | C10H20O8 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (3S,4R)-3,4,5-trihydroxypentanal;3,4,5-trihydroxypentanal |
| SMILES | O=CCC(O)C(O)CO.O=CC[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/2C5H10O4/c2*6-2-1-4(8)5(9)3-7/h2*2,4-5,7-9H,1,3H2/t4-,5+;/m0./s1 |
| InChIKey | GTHPEIHLIPRMPG-UYXJWNHNSA-N |
| XLogP | -3.42 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|