C7H14O4 — CID 88980061
(3R)-3-ethoxy-4,5-dihydroxypentanal (PubChem CID 88980061) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is (3R)-3-ethoxy-4,5-dihydroxypentanal.
| Compound Name | (3R)-3-ethoxy-4,5-dihydroxypentanal |
|---|---|
| PubChem CID | 88980061 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (3R)-3-ethoxy-4,5-dihydroxypentanal |
| SMILES | CCO[C@H](CC=O)C(O)CO |
| InChI | InChI=1S/C7H14O4/c1-2-11-7(3-4-8)6(10)5-9/h4,6-7,9-10H,2-3,5H2,1H3/t6?,7-/m1/s1 |
| InChIKey | SCBVORFRPKFGRV-COBSHVIPSA-N |
| XLogP | -0.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|