C11H25NO4 — CID 88979921
(3R)-8-amino-3-ethoxy-5-methyloctane-1,2,8-triol (PubChem CID 88979921) has the molecular formula C11H25NO4 and a molecular weight of 235.32 g/mol. Its IUPAC name is (3R)-8-amino-3-ethoxy-5-methyloctane-1,2,8-triol.
| Compound Name | (3R)-8-amino-3-ethoxy-5-methyloctane-1,2,8-triol |
|---|---|
| PubChem CID | 88979921 |
| Molecular Formula | C11H25NO4 |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | (3R)-8-amino-3-ethoxy-5-methyloctane-1,2,8-triol |
| SMILES | CCO[C@H](CC(C)CCC(N)O)C(O)CO |
| InChI | InChI=1S/C11H25NO4/c1-3-16-10(9(14)7-13)6-8(2)4-5-11(12)15/h8-11,13-15H,3-7,12H2,1-2H3/t8?,9?,10-,11?/m1/s1 |
| InChIKey | VJFOHUHWFUADRS-VEKQPKGLSA-N |
| XLogP | -0.17 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|