C11H24O4 — CID 174961473
4-ethoxynonane-1,2,3-triol (PubChem CID 174961473) has the molecular formula C11H24O4 and a molecular weight of 220.31 g/mol. Its IUPAC name is 4-ethoxynonane-1,2,3-triol.
| Compound Name | 4-ethoxynonane-1,2,3-triol |
|---|---|
| PubChem CID | 174961473 |
| Molecular Formula | C11H24O4 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 4-ethoxynonane-1,2,3-triol |
| SMILES | CCCCCC(OCC)C(O)C(O)CO |
| InChI | InChI=1S/C11H24O4/c1-3-5-6-7-10(15-4-2)11(14)9(13)8-12/h9-14H,3-8H2,1-2H3 |
| InChIKey | ZACSHHKUPCJSGM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|