C24H50O4 — CID 91120456
(2R,3R)-12-methyl-4-(8-methylnonoxy)tridecane-1,2,3-triol (PubChem CID 91120456) has the molecular formula C24H50O4 and a molecular weight of 402.66 g/mol. Its IUPAC name is (2R,3R)-12-methyl-4-(8-methylnonoxy)tridecane-1,2,3-triol.
| Compound Name | (2R,3R)-12-methyl-4-(8-methylnonoxy)tridecane-1,2,3-triol |
|---|---|
| PubChem CID | 91120456 |
| Molecular Formula | C24H50O4 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.37 |
| IUPAC Name | (2R,3R)-12-methyl-4-(8-methylnonoxy)tridecane-1,2,3-triol |
| SMILES | CC(C)CCCCCCCOC(CCCCCCCC(C)C)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C24H50O4/c1-20(2)15-11-7-5-9-13-17-23(24(27)22(26)19-25)28-18-14-10-6-8-12-16-21(3)4/h20-27H,5-19H2,1-4H3/t22-,23?,24-/m1/s1 |
| InChIKey | MYISWEQWUIYQOD-NZNOWSIYSA-N |
| XLogP | 5.47 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|