C13H28O6 — CID 101385916
(2S,3S,4S,5S)-4-(5-methylhexoxy)hexane-1,2,3,5,6-pentol (PubChem CID 101385916) has the molecular formula C13H28O6 and a molecular weight of 280.36 g/mol. Its IUPAC name is (2S,3S,4S,5S)-4-(5-methylhexoxy)hexane-1,2,3,5,6-pentol.
| Compound Name | (2S,3S,4S,5S)-4-(5-methylhexoxy)hexane-1,2,3,5,6-pentol |
|---|---|
| PubChem CID | 101385916 |
| Molecular Formula | C13H28O6 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (2S,3S,4S,5S)-4-(5-methylhexoxy)hexane-1,2,3,5,6-pentol |
| SMILES | CC(C)CCCCO[C@H]([C@@H](O)[C@@H](O)CO)[C@@H](O)CO |
| InChI | InChI=1S/C13H28O6/c1-9(2)5-3-4-6-19-13(11(17)8-15)12(18)10(16)7-14/h9-18H,3-8H2,1-2H3/t10-,11-,12-,13-/m0/s1 |
| InChIKey | FZFZSUCGIXGHKN-CYDGBPFRSA-N |
| XLogP | -0.73 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|