C9H21NO4 — CID 167414432
(2S,3S,4S)-4-amino-3-butoxypentane-1,2,5-triol (PubChem CID 167414432) has the molecular formula C9H21NO4 and a molecular weight of 207.27 g/mol. Its IUPAC name is (2S,3S,4S)-4-amino-3-butoxypentane-1,2,5-triol.
| Compound Name | (2S,3S,4S)-4-amino-3-butoxypentane-1,2,5-triol |
|---|---|
| PubChem CID | 167414432 |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | (2S,3S,4S)-4-amino-3-butoxypentane-1,2,5-triol |
| SMILES | CCCCO[C@@H]([C@@H](N)CO)[C@@H](O)CO |
| InChI | InChI=1S/C9H21NO4/c1-2-3-4-14-9(7(10)5-11)8(13)6-12/h7-9,11-13H,2-6,10H2,1H3/t7-,8-,9-/m0/s1 |
| InChIKey | DCMIGELAVSYSHD-CIUDSAMLSA-N |
| XLogP | -1.16 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|