C15H34O5 — CID 87392981
1-[1-(1-butoxyethoxy)ethoxy]butane;propane-1,2-diol (PubChem CID 87392981) has the molecular formula C15H34O5 and a molecular weight of 294.43 g/mol. Its IUPAC name is 1-[1-(1-butoxyethoxy)ethoxy]butane;propane-1,2-diol.
| Compound Name | 1-[1-(1-butoxyethoxy)ethoxy]butane;propane-1,2-diol |
|---|---|
| PubChem CID | 87392981 |
| Molecular Formula | C15H34O5 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | 1-[1-(1-butoxyethoxy)ethoxy]butane;propane-1,2-diol |
| SMILES | CC(O)CO.CCCCOC(C)OC(C)OCCCC |
| InChI | InChI=1S/C12H26O3.C3H8O2/c1-5-7-9-13-11(3)15-12(4)14-10-8-6-2;1-3(5)2-4/h11-12H,5-10H2,1-4H3;3-5H,2H2,1H3 |
| InChIKey | QTRGFKKGVYTAIH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|