C6H14O11P2 — CID 21124437
[(1S,2S)-1-[(1R)-1,2-dihydroxyethyl]-4-oxo-2-phosphonooxybutyl] dihydrogen phosphate (PubChem CID 21124437) has the molecular formula C6H14O11P2 and a molecular weight of 324.12 g/mol. Its IUPAC name is [(1S,2S)-1-[(1R)-1,2-dihydroxyethyl]-4-oxo-2-phosphonooxybutyl] dihydrogen phosphate.
| Compound Name | [(1S,2S)-1-[(1R)-1,2-dihydroxyethyl]-4-oxo-2-phosphonooxybutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 21124437 |
| Molecular Formula | C6H14O11P2 |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | [(1S,2S)-1-[(1R)-1,2-dihydroxyethyl]-4-oxo-2-phosphonooxybutyl] dihydrogen phosphate |
| SMILES | O=CC[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](O)CO |
| InChI | InChI=1S/C6H14O11P2/c7-2-1-5(16-18(10,11)12)6(4(9)3-8)17-19(13,14)15/h2,4-6,8-9H,1,3H2,(H2,10,11,12)(H2,13,14,15)/t4-,5+,6+/m1/s1 |
| InChIKey | VPTIYJAJARPUCV-SRQIZXRXSA-N |
| XLogP | -2.12 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|