C6H13O8P — CID 154176240
[(2R,3S,4R)-1,3,4-trihydroxy-6-oxohexan-2-yl] dihydrogen phosphate (PubChem CID 154176240) has the molecular formula C6H13O8P and a molecular weight of 244.14 g/mol. Its IUPAC name is [(2R,3S,4R)-1,3,4-trihydroxy-6-oxohexan-2-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4R)-1,3,4-trihydroxy-6-oxohexan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 154176240 |
| Molecular Formula | C6H13O8P |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | [(2R,3S,4R)-1,3,4-trihydroxy-6-oxohexan-2-yl] dihydrogen phosphate |
| SMILES | O=CC[C@@H](O)[C@H](O)[C@@H](CO)OP(=O)(O)O |
| InChI | InChI=1S/C6H13O8P/c7-2-1-4(9)6(10)5(3-8)14-15(11,12)13/h2,4-6,8-10H,1,3H2,(H2,11,12,13)/t4-,5-,6+/m1/s1 |
| InChIKey | OTRIHONNXOWWGO-PBXRRBTRSA-N |
| XLogP | -2.23 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|