C10H22O5 — CID 57312737
3-(1,2-dihydroxypentan-3-yloxy)pentane-1,2-diol (PubChem CID 57312737) has the molecular formula C10H22O5 and a molecular weight of 222.28 g/mol. Its IUPAC name is 3-(1,2-dihydroxypentan-3-yloxy)pentane-1,2-diol.
| Compound Name | 3-(1,2-dihydroxypentan-3-yloxy)pentane-1,2-diol |
|---|---|
| PubChem CID | 57312737 |
| Molecular Formula | C10H22O5 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 3-(1,2-dihydroxypentan-3-yloxy)pentane-1,2-diol |
| SMILES | CCC(OC(CC)C(O)CO)C(O)CO |
| InChI | InChI=1S/C10H22O5/c1-3-9(7(13)5-11)15-10(4-2)8(14)6-12/h7-14H,3-6H2,1-2H3 |
| InChIKey | FFYXLNLXTMBCLL-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |