C7H16O5 — CID 174720199
(2R,3R)-3-propan-2-ylperoxybutane-1,2,4-triol (PubChem CID 174720199) has the molecular formula C7H16O5 and a molecular weight of 180.20 g/mol. Its IUPAC name is (2R,3R)-3-propan-2-ylperoxybutane-1,2,4-triol.
| Compound Name | (2R,3R)-3-propan-2-ylperoxybutane-1,2,4-triol |
|---|---|
| PubChem CID | 174720199 |
| Molecular Formula | C7H16O5 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (2R,3R)-3-propan-2-ylperoxybutane-1,2,4-triol |
| SMILES | CC(C)OO[C@H](CO)[C@H](O)CO |
| InChI | InChI=1S/C7H16O5/c1-5(2)11-12-7(4-9)6(10)3-8/h5-10H,3-4H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | ZEJODHZCYMMKSV-RNFRBKRXSA-N |
| XLogP | -0.94 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|