C8H18O3 — CID 58078764
(2S,3S)-2-propan-2-yloxypentane-1,3-diol (PubChem CID 58078764) has the molecular formula C8H18O3 and a molecular weight of 162.23 g/mol. Its IUPAC name is (2S,3S)-2-propan-2-yloxypentane-1,3-diol.
| Compound Name | (2S,3S)-2-propan-2-yloxypentane-1,3-diol |
|---|---|
| PubChem CID | 58078764 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | (2S,3S)-2-propan-2-yloxypentane-1,3-diol |
| SMILES | CC[C@H](O)[C@H](CO)OC(C)C |
| InChI | InChI=1S/C8H18O3/c1-4-7(10)8(5-9)11-6(2)3/h6-10H,4-5H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | YJIFHWBSHWNISN-YUMQZZPRSA-N |
| XLogP | 0.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |