About ethanol;1-propan-2-yloxyethanol
ethanol;1-propan-2-yloxyethanol (PubChem CID 87638042) has the molecular formula C7H18O3
and a molecular weight of 150.22 g/mol. Its IUPAC name is ethanol;1-propan-2-yloxyethanol.
Molecular Properties
| Compound Name | ethanol;1-propan-2-yloxyethanol |
| PubChem CID | 87638042 |
| Molecular Formula | C7H18O3 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.13 |
| IUPAC Name | ethanol;1-propan-2-yloxyethanol |
| SMILES | CC(C)OC(C)O.CCO |
| InChI | InChI=1S/C5H12O2.C2H6O/c1-4(2)7-5(3)6;1-2-3/h4-6H,1-3H3;3H,2H2,1H3 |
| InChIKey | NEFSFWWIYYMIET-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethanol;1-propan-2-yloxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;1-propan-2-yloxyethanol?
The IUPAC name of ethanol;1-propan-2-yloxyethanol (CID 87638042) is ethanol;1-propan-2-yloxyethanol.
What is the SMILES notation for ethanol;1-propan-2-yloxyethanol?
The canonical SMILES for ethanol;1-propan-2-yloxyethanol is CC(C)OC(C)O.CCO.
What is the InChIKey of ethanol;1-propan-2-yloxyethanol?
The InChIKey is NEFSFWWIYYMIET-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.C2H6O/c1-4(2)7-5(3)6;1-2-3/h4-6H,1-3H3;3H,2H2,1H3.
What are the key properties of ethanol;1-propan-2-yloxyethanol?
ethanol;1-propan-2-yloxyethanol has a molecular weight of 150.22 g/mol, XLogP of 0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;1-propan-2-yloxyethanol is sourced from PubChem (CID 87638042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).