C9H17F3O5S — CID 58078761
[(2S,3S)-3-hydroxy-2-propan-2-yloxypentyl] trifluoromethanesulfonate (PubChem CID 58078761) has the molecular formula C9H17F3O5S and a molecular weight of 294.29 g/mol. Its IUPAC name is [(2S,3S)-3-hydroxy-2-propan-2-yloxypentyl] trifluoromethanesulfonate.
| Compound Name | [(2S,3S)-3-hydroxy-2-propan-2-yloxypentyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58078761 |
| Molecular Formula | C9H17F3O5S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | [(2S,3S)-3-hydroxy-2-propan-2-yloxypentyl] trifluoromethanesulfonate |
| SMILES | CC[C@H](O)[C@H](COS(=O)(=O)C(F)(F)F)OC(C)C |
| InChI | InChI=1S/C9H17F3O5S/c1-4-7(13)8(17-6(2)3)5-16-18(14,15)9(10,11)12/h6-8,13H,4-5H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | ATTZNJAVDGIGIC-YUMQZZPRSA-N |
| XLogP | 1.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|