C8H8F10O6S2 — CID 87128082
2-(1,1,2,2,2-pentafluoroethylsulfonyloxy)butyl 1,1,2,2,2-pentafluoroethanesulfonate (PubChem CID 87128082) has the molecular formula C8H8F10O6S2 and a molecular weight of 454.26 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethylsulfonyloxy)butyl 1,1,2,2,2-pentafluoroethanesulfonate.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethylsulfonyloxy)butyl 1,1,2,2,2-pentafluoroethanesulfonate |
|---|---|
| PubChem CID | 87128082 |
| Molecular Formula | C8H8F10O6S2 |
| Molecular Weight | 454.26 g/mol |
| Exact Mass | 453.96 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethylsulfonyloxy)butyl 1,1,2,2,2-pentafluoroethanesulfonate |
| SMILES | CCC(COS(=O)(=O)C(F)(F)C(F)(F)F)OS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8F10O6S2/c1-2-4(24-26(21,22)8(17,18)6(12,13)14)3-23-25(19,20)7(15,16)5(9,10)11/h4H,2-3H2,1H3 |
| InChIKey | QSSZWSDFHNEACC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|