C8H10F6O7S2 — CID 177445546
[3-prop-2-enoxy-2-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate (PubChem CID 177445546) has the molecular formula C8H10F6O7S2 and a molecular weight of 396.28 g/mol. Its IUPAC name is [3-prop-2-enoxy-2-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate.
| Compound Name | [3-prop-2-enoxy-2-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 177445546 |
| Molecular Formula | C8H10F6O7S2 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | [3-prop-2-enoxy-2-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate |
| SMILES | C=CCOCC(COS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F6O7S2/c1-2-3-19-4-6(21-23(17,18)8(12,13)14)5-20-22(15,16)7(9,10)11/h2,6H,1,3-5H2 |
| InChIKey | JUGZLWVGGVCICQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|