C8H12O7 — CID 87261802
(1-carboxyoxy-3-prop-2-enoxypropan-2-yl) hydrogen carbonate (PubChem CID 87261802) has the molecular formula C8H12O7 and a molecular weight of 220.18 g/mol. Its IUPAC name is (1-carboxyoxy-3-prop-2-enoxypropan-2-yl) hydrogen carbonate.
| Compound Name | (1-carboxyoxy-3-prop-2-enoxypropan-2-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 87261802 |
| Molecular Formula | C8H12O7 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | (1-carboxyoxy-3-prop-2-enoxypropan-2-yl) hydrogen carbonate |
| SMILES | C=CCOCC(COC(=O)O)OC(=O)O |
| InChI | InChI=1S/C8H12O7/c1-2-3-13-4-6(15-8(11)12)5-14-7(9)10/h2,6H,1,3-5H2,(H,9,10)(H,11,12) |
| InChIKey | BIPJDXHFGFAKOU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|