C10H15NaO9S — CID 139676672
sodium 4-(1-hydroxy-3-prop-2-enoxypropan-2-yl)oxy-4-oxo-3-sulfobutanoate (PubChem CID 139676672) has the molecular formula C10H15NaO9S and a molecular weight of 334.28 g/mol. Its IUPAC name is sodium 4-(1-hydroxy-3-prop-2-enoxypropan-2-yl)oxy-4-oxo-3-sulfobutanoate.
| Compound Name | sodium 4-(1-hydroxy-3-prop-2-enoxypropan-2-yl)oxy-4-oxo-3-sulfobutanoate |
|---|---|
| PubChem CID | 139676672 |
| Molecular Formula | C10H15NaO9S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | sodium 4-(1-hydroxy-3-prop-2-enoxypropan-2-yl)oxy-4-oxo-3-sulfobutanoate |
| SMILES | C=CCOCC(CO)OC(=O)C(CC(=O)[O-])S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C10H16O9S.Na/c1-2-3-18-6-7(5-11)19-10(14)8(4-9(12)13)20(15,16)17;/h2,7-8,11H,1,3-6H2,(H,12,13)(H,15,16,17);/q;+1/p-1 |
| InChIKey | CZOOXPSAGSYJGE-UHFFFAOYSA-M |
| XLogP | -5.51 |
| TPSA | 150.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | -5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|