C14H25NaO7S — CID 161399413
sodium 4-decoxy-4-oxo-3-sulfobutanoate (PubChem CID 161399413) has the molecular formula C14H25NaO7S and a molecular weight of 360.40 g/mol. Its IUPAC name is sodium 4-decoxy-4-oxo-3-sulfobutanoate.
| Compound Name | sodium 4-decoxy-4-oxo-3-sulfobutanoate |
|---|---|
| PubChem CID | 161399413 |
| Molecular Formula | C14H25NaO7S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | sodium 4-decoxy-4-oxo-3-sulfobutanoate |
| SMILES | CCCCCCCCCCOC(=O)C(CC(=O)[O-])S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C14H26O7S.Na/c1-2-3-4-5-6-7-8-9-10-21-14(17)12(11-13(15)16)22(18,19)20;/h12H,2-11H2,1H3,(H,15,16)(H,18,19,20);/q;+1/p-1 |
| InChIKey | VUAPWJOZAXCYTE-UHFFFAOYSA-M |
| XLogP | -1.93 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|