C4H4KNaO7S — CID 159603821
potassium;sodium;2-sulfobutanedioate (PubChem CID 159603821) has the molecular formula C4H4KNaO7S and a molecular weight of 258.22 g/mol. Its IUPAC name is potassium;sodium;2-sulfobutanedioate.
| Compound Name | potassium;sodium;2-sulfobutanedioate |
|---|---|
| PubChem CID | 159603821 |
| Molecular Formula | C4H4KNaO7S |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 257.92 |
| IUPAC Name | potassium;sodium;2-sulfobutanedioate |
| SMILES | O=C([O-])CC(C(=O)[O-])S(=O)(=O)O.[K+].[Na+] |
| InChI | InChI=1S/C4H6O7S.K.Na/c5-3(6)1-2(4(7)8)12(9,10)11;;/h2H,1H2,(H,5,6)(H,7,8)(H,9,10,11);;/q;2*+1/p-2 |
| InChIKey | MLUYVFGOLWJPNE-UHFFFAOYSA-L |
| XLogP | -9.86 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | -9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|