C8H10CoO11S — CID 174521717
butanedioic acid;cobalt(2+);2-sulfobutanedioate (PubChem CID 174521717) has the molecular formula C8H10CoO11S and a molecular weight of 373.16 g/mol. Its IUPAC name is butanedioic acid;cobalt(2+);2-sulfobutanedioate.
| Compound Name | butanedioic acid;cobalt(2+);2-sulfobutanedioate |
|---|---|
| PubChem CID | 174521717 |
| Molecular Formula | C8H10CoO11S |
| Molecular Weight | 373.16 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | butanedioic acid;cobalt(2+);2-sulfobutanedioate |
| SMILES | O=C(O)CCC(=O)O.O=C([O-])CC(C(=O)[O-])S(=O)(=O)O.[Co+2] |
| InChI | InChI=1S/C4H6O7S.C4H6O4.Co/c5-3(6)1-2(4(7)8)12(9,10)11;5-3(6)1-2-4(7)8;/h2H,1H2,(H,5,6)(H,7,8)(H,9,10,11);1-2H2,(H,5,6)(H,7,8);/q;;+2/p-2 |
| InChIKey | ANUDYMVJMGGVEP-UHFFFAOYSA-L |
| XLogP | -3.93 |
| TPSA | 209.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.16 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|