About butanedioic acid;sulfane;sulfuric acid
butanedioic acid;sulfane;sulfuric acid (PubChem CID 172824960) has the molecular formula C4H10O8S2
and a molecular weight of 250.25 g/mol. Its IUPAC name is butanedioic acid;sulfane;sulfuric acid.
Molecular Properties
| Compound Name | butanedioic acid;sulfane;sulfuric acid |
| PubChem CID | 172824960 |
| Molecular Formula | C4H10O8S2 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | butanedioic acid;sulfane;sulfuric acid |
| SMILES | O=C(O)CCC(=O)O.O=S(=O)(O)O.S |
| InChI | InChI=1S/C4H6O4.H2O4S.H2S/c5-3(6)1-2-4(7)8;1-5(2,3)4;/h1-2H2,(H,5,6)(H,7,8);(H2,1,2,3,4);1H2 |
| InChIKey | USRZEQSZZLPGFK-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze butanedioic acid;sulfane;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;sulfane;sulfuric acid?
The IUPAC name of butanedioic acid;sulfane;sulfuric acid (CID 172824960) is butanedioic acid;sulfane;sulfuric acid.
What is the SMILES notation for butanedioic acid;sulfane;sulfuric acid?
The canonical SMILES for butanedioic acid;sulfane;sulfuric acid is O=C(O)CCC(=O)O.O=S(=O)(O)O.S.
What is the InChIKey of butanedioic acid;sulfane;sulfuric acid?
The InChIKey is USRZEQSZZLPGFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4.H2O4S.H2S/c5-3(6)1-2-4(7)8;1-5(2,3)4;/h1-2H2,(H,5,6)(H,7,8);(H2,1,2,3,4);1H2.
What are the key properties of butanedioic acid;sulfane;sulfuric acid?
butanedioic acid;sulfane;sulfuric acid has a molecular weight of 250.25 g/mol, XLogP of -0.60, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;sulfane;sulfuric acid is sourced from PubChem (CID 172824960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).