C8H13NO10S — CID 157095535
4-amino-4-oxobutanoic acid;2-sulfobutanedioic acid (PubChem CID 157095535) has the molecular formula C8H13NO10S and a molecular weight of 315.26 g/mol. Its IUPAC name is 4-amino-4-oxobutanoic acid;2-sulfobutanedioic acid.
| Compound Name | 4-amino-4-oxobutanoic acid;2-sulfobutanedioic acid |
|---|---|
| PubChem CID | 157095535 |
| Molecular Formula | C8H13NO10S |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 4-amino-4-oxobutanoic acid;2-sulfobutanedioic acid |
| SMILES | NC(=O)CCC(=O)O.O=C(O)CC(C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C4H7NO3.C4H6O7S/c5-3(6)1-2-4(7)8;5-3(6)1-2(4(7)8)12(9,10)11/h1-2H2,(H2,5,6)(H,7,8);2H,1H2,(H,5,6)(H,7,8)(H,9,10,11) |
| InChIKey | AFDZDFWKICTOHB-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 209.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|